CAS 66041-28-9 appears in our catalog under these names: 2-(3-Chloro-phenyl)-succinic acid, 95%, 2-(3-Chlorophenyl)succinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
2-(3-chlorophenyl)butanedioic acid (CAS 66041-28-9) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: 2-(3-chlorophenyl)butanedioic acid. InChIKey: OUPCJGJSIKKQND-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-(3-chlorophenyl)butanedioic acid |
| InChIKey | OUPCJGJSIKKQND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)