CAS 915921-98-1 is the registry number for (7-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid (CAS 915921-98-1) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: 2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid. InChIKey: LGLSIVKEHGQKRR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid |
| InChIKey | LGLSIVKEHGQKRR-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Cl)CC(=O)O |
Computed by PubChem (NCBI)