cas: 110768-31-5 — see every product listed under this CAS number, including other names
2-(2-Methylphenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid, 95% (CAS 110768-31-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1008747-10g |
| cas | 110768-31-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln | |
| AmBeed | 5g | 10733.38 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 110768-31-5) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: XVDRNJOUTFCUSS-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | XVDRNJOUTFCUSS-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)