CAS 1253768-91-0 appears in our catalog under these names: Nintedanib Impurity 50, Nintedanib Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.
3-benzoyl-2-hydroxy-1H-indole-6-carboxylic acid (CAS 1253768-91-0) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 3-benzoyl-2-hydroxy-1H-indole-6-carboxylic acid. InChIKey: AGCFZWVCRYAHIR-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 3-benzoyl-2-hydroxy-1H-indole-6-carboxylic acid |
| InChIKey | AGCFZWVCRYAHIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(NC3=C2C=CC(=C3)C(=O)O)O |
Computed by PubChem (NCBI)