CAS 925000-99-3 is the registry number for 5-(4-Phenoxyphenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-phenoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 925000-99-3) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 5-(4-phenoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: CUEWICQMXPNFNX-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 5-(4-phenoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | CUEWICQMXPNFNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=CC(=NO3)C(=O)O |
Computed by PubChem (NCBI)