cas: 588-22-7 — see every product listed under this CAS number, including other names
2-(3,4-Dichlorophenoxy)acetic acid, 97%, 97% (CAS 588-22-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IGD-100mg |
| cas | 588-22-7 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 750.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,4-dichlorophenoxyacetic acid is a chlorophenoxyacetic acid that is phenoxyacetic acid in which the hydrogens at positions 3 and 4 of the phenyl group are replaced by chlorines. It has a role as a phenoxy herbicide.
Source: ChEBI
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)acetic acid |
| InChIKey | SNYRXHULAWEECU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)