2-(3-Boronophenyl)acetic acid 98%
cas: 914397-60-7 — see every product listed under this CAS number, including other names
2-(3-Boronophenyl)acetic acid 98% (CAS 914397-60-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A525280-50mg |
| cas | 914397-60-7 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 231.31 Pln | |
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3735.69 Pln | |
| Ambeed | 10g | 7395.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A525280 |
2-(3-boronophenyl)acetic acid (CAS 914397-60-7) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2-(3-boronophenyl)acetic acid. InChIKey: UQOJWKCPHDCNQS-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2-(3-boronophenyl)acetic acid |
| InChIKey | UQOJWKCPHDCNQS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CC(=O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Carboxymethyl)benzeneboronic acid, 2-(3-Boronophenyl)acetic acid, 3-(Carboxymethyl)phenylboronic acid, Benzeneacetic acid, 3-borono-, 2-(3-Boronophenyl)aceticacid, 2-(3-Boronophenyl), (3-Boronophenyl)acetic acid, 3-carboxymethylphenylboronic acid, 3-Acetic acid benzeneboronic acid, UQOJWKCPHDCNQS-UHFFFAOYSA-N