cas: 5565-72-0 — see every product listed under this CAS number, including other names
2-(3-Nitrophenyl)-1,3,4-oxadiazole, 98%, 98% (CAS 5565-72-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E225-250mg |
| cas | 5565-72-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 712.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-nitrophenyl)-1,3,4-oxadiazole (CAS 5565-72-0) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 2-(3-nitrophenyl)-1,3,4-oxadiazole. InChIKey: NSIRBOSXFXTYQL-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | NSIRBOSXFXTYQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NN=CO2 |
Computed by PubChem (NCBI)