CAS 90049-83-5 appears in our catalog under these names: 3-(3-Nitrophenyl)-1,2,4-oxadiazole, 95%, 3-(3-Nitrophenyl)-1,2,4-oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
3-(3-nitrophenyl)-1,2,4-oxadiazole (CAS 90049-83-5) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 3-(3-nitrophenyl)-1,2,4-oxadiazole. InChIKey: BXMPGUQFWQUYRY-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | BXMPGUQFWQUYRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NOC=N2 |
Computed by PubChem (NCBI)