CAS 1375064-55-3 appears in our catalog under these names: 5-(2-PYRAZINYL)ISOXAZOLE-3-CARBOXYLIC ACID, 5-(2-Pyrazinyl)isoxazole-3-carboxylic acid, 95%, 5-(2-Pyrazinyl)isoxazole-3-carboxylic Acid, >95%, >95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-pyrazin-2-yl-1,2-oxazole-3-carboxylic acid (CAS 1375064-55-3) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 5-pyrazin-2-yl-1,2-oxazole-3-carboxylic acid. InChIKey: LGEIAXHZEBTDSN-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 5-pyrazin-2-yl-1,2-oxazole-3-carboxylic acid |
| InChIKey | LGEIAXHZEBTDSN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)