CAS 517895-72-6 is the registry number for 7-Nitro-pyrido[1,2-a]pyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
7-nitropyrido[1,2-a]pyrimidin-4-one (CAS 517895-72-6) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 7-nitropyrido[1,2-a]pyrimidin-4-one. InChIKey: UKEOGGMUOLVIJZ-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 7-nitropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | UKEOGGMUOLVIJZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=O)N2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)