CAS 2229271-45-6 is the registry number for 5-(Pyrimidin-5-yl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-pyrimidin-5-yl-1,2-oxazole-3-carboxylic acid (CAS 2229271-45-6) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 5-pyrimidin-5-yl-1,2-oxazole-3-carboxylic acid. InChIKey: FUPHUSMVQHCRRP-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 5-pyrimidin-5-yl-1,2-oxazole-3-carboxylic acid |
| InChIKey | FUPHUSMVQHCRRP-UHFFFAOYSA-N |
| SMILES | C1=C(ON=C1C(=O)O)C2=CN=CN=C2 |
Computed by PubChem (NCBI)