Products 1408075-65-9
CAS 1408075-65-9 appears in our catalog under these names: 3-Nitro-1,6-naphthyridin-5(6h)-one, 95%, 3-Nitro-1,6-naphthyridin-5(6H)-one, 3-Nitro-1,6-naphthyridin-5(6H)-one, 98+%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 750mg, 250mg, 0,5g, 50mg.
3-nitro-6H-1,6-naphthyridin-5-one (CAS 1408075-65-9) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 3-nitro-6H-1,6-naphthyridin-5-one. InChIKey: MLPJIQYHSLWMLH-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 3-nitro-6H-1,6-naphthyridin-5-one |
| InChIKey | MLPJIQYHSLWMLH-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C1N=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)