Products 16013-14-2
CAS 16013-14-2 appears in our catalog under these names: 3-(4-Nitrophenyl)-1,2,4-oxadiazole, 95%, 3–(4–nitrophenyl)–1，2，4–oxadiazole, 3-(4-Nitrophenyl)-1,2,4-oxadiazole, 3-(4-Nitrophenyl)-1,2,4-oxadiazole, 98%, 98%, 3-(4-nitrophenyl)-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g, 100mg, 25g.
3-(4-nitrophenyl)-1,2,4-oxadiazole (CAS 16013-14-2) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 3-(4-nitrophenyl)-1,2,4-oxadiazole. InChIKey: KWOHXJCKLMGBFD-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 3-(4-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | KWOHXJCKLMGBFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)