CAS 4291-13-8 appears in our catalog under these names: 2-(4-Nitrophenyl)-1,3,4-oxadiazole, 98%, 2-(4-nitrophenyl)-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g.
2-(4-nitrophenyl)-1,3,4-oxadiazole (CAS 4291-13-8) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3,4-oxadiazole. InChIKey: FBQDNDLFVIKPRJ-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | FBQDNDLFVIKPRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)