CAS 89898-92-0 is the registry number for 2-(2-Nitrophenyl)-1,3,4-oxadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-(2-nitrophenyl)-1,3,4-oxadiazole (CAS 89898-92-0) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 2-(2-nitrophenyl)-1,3,4-oxadiazole. InChIKey: WXKRXSFMMMXAKR-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 2-(2-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | WXKRXSFMMMXAKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)