cas: 773087-43-7 — see every product listed under this CAS number, including other names
2-(4-Bromo-2,6-difluorophenyl)-1,3-dioxolane (CAS 773087-43-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F450606-5G |
| cas | 773087-43-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 10g | 1924.34 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-bromo-2,6-difluorophenyl)-1,3-dioxolane (CAS 773087-43-7) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 2-(4-bromo-2,6-difluorophenyl)-1,3-dioxolane. InChIKey: WTFMOVNMFQDXNI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 2-(4-bromo-2,6-difluorophenyl)-1,3-dioxolane |
| InChIKey | WTFMOVNMFQDXNI-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2F)Br)F |
Computed by PubChem (NCBI)