Products 1309933-04-7
CAS 1309933-04-7 appears in our catalog under these names: Ethyl 3-bromo-2,6-difluorobenzoate, 95%, Ethyl 3-bromo-2,6-difluorobenzoate, 95+%, Ethyl 3-bromo-2,6-difluorobenzoate, 98%, 98%, Ethyl 3-bromo-2,6-difluorobenzoate, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg, 500mg.
Ethyl 3-bromo-2,6-difluorobenzoate (CAS 1309933-04-7) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 3-bromo-2,6-difluorobenzoate. InChIKey: LKIQAXWEIBVROY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 3-bromo-2,6-difluorobenzoate |
| InChIKey | LKIQAXWEIBVROY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)Br)F |
Computed by PubChem (NCBI)