Products 58755-91-2
CAS 58755-91-2 is the registry number for 2-(4-Chloro-phenyl)-succinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
2-(4-chlorophenyl)butanedioic acid (CAS 58755-91-2) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: 2-(4-chlorophenyl)butanedioic acid. InChIKey: AGFXJIDIVHRKCA-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-(4-chlorophenyl)butanedioic acid |
| InChIKey | AGFXJIDIVHRKCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-Chlorophenyl)succinic acid, 2-(4-chlorophenyl)butanedioic acid, 2-(4-Chlorophenyl)-butanedioic acid, butanedioic acid, 2-(4-chlorophenyl)-, .alpha.-[p-Chlorophenyl]succinic acid, p-Chlorophenylsuccinic acid, 2-(4-Chlorophenyl)succinicacid, AGFXJIDIVHRKCA-UHFFFAOYSA-N, 2-(4-Chlorophenyl)succinic acid #