cas: 2377575-83-0 — see every product listed under this CAS number, including other names
2-(5-Bromo-2,4-difluorophenyl)-1,3-dioxolane, ≥95%, ≥95% (CAS 2377575-83-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12W0N6-1g |
| cas | 2377575-83-0 |
| size | 1g |
| availability | 44g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 856.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(5-bromo-2,4-difluorophenyl)-1,3-dioxolane (CAS 2377575-83-0) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 2-(5-bromo-2,4-difluorophenyl)-1,3-dioxolane. InChIKey: OIJJRBALXSYZGV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 2-(5-bromo-2,4-difluorophenyl)-1,3-dioxolane |
| InChIKey | OIJJRBALXSYZGV-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2F)F)Br |
Computed by PubChem (NCBI)