cas: 84627-04-3 — see every product listed under this CAS number, including other names
2-(6-Hydroxy-[1,1'-biphenyl]-3-carbonyl)benzoic acid, 97% (CAS 84627-04-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A991365-1g |
| cas | 84627-04-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 153.44 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 904.38 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 158.86 Pln | |
| BLDpharm | 25g | 342.13 Pln | |
| BLDpharm | 100g | 969.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-hydroxy-3-phenylbenzoyl)benzoic acid (CAS 84627-04-3) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: 2-(4-hydroxy-3-phenylbenzoyl)benzoic acid. InChIKey: PKHPZNKXOBWFCX-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 2-(4-hydroxy-3-phenylbenzoyl)benzoic acid |
| InChIKey | PKHPZNKXOBWFCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)C(=O)C3=CC=CC=C3C(=O)O)O |
Computed by PubChem (NCBI)