cas: 24351-54-0 — see every product listed under this CAS number, including other names
2-(Benzo(d)(1,3)dioxol-5-yl)benzoic acid, 98% (CAS 24351-54-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A341439-250mg |
| cas | 24351-54-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 310.87 Pln | |
| AmBeed | 100mg | 167.65 Pln | |
| AmBeed | 5g | 4444.72 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(1,3-benzodioxol-5-yl)benzoic acid (CAS 24351-54-0) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)benzoic acid. InChIKey: PEOCCFXRLGYKBM-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)benzoic acid |
| InChIKey | PEOCCFXRLGYKBM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)