cas: 24351-54-0 — see every product listed under this CAS number, including other names
2-Biphenyl-[1,3]dioxol-5-yl-carboxylic acid, 98% (CAS 24351-54-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011470-250MG |
| cas | 24351-54-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 3475.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(1,3-benzodioxol-5-yl)benzoic acid (CAS 24351-54-0) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)benzoic acid. InChIKey: PEOCCFXRLGYKBM-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)benzoic acid |
| InChIKey | PEOCCFXRLGYKBM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)