cas: 942143-10-4 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-1-bromo-3,5-difluorobenzene, 97%, 97% (CAS 942143-10-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EZ0-100mg |
| cas | 942143-10-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 194.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3,5-difluoro-2-phenylmethoxybenzene (CAS 942143-10-4) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 1-bromo-3,5-difluoro-2-phenylmethoxybenzene. InChIKey: NDAUCIQBUUEETC-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 1-bromo-3,5-difluoro-2-phenylmethoxybenzene |
| InChIKey | NDAUCIQBUUEETC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)F)F |
Computed by PubChem (NCBI)