CAS 1042702-93-1 is the registry number for 5-(Benzyloxy)-2-bromo-1,3-difluorobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1,3-difluoro-5-phenylmethoxybenzene (CAS 1042702-93-1) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 2-bromo-1,3-difluoro-5-phenylmethoxybenzene. InChIKey: MMGUMGXGICRLQH-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 2-bromo-1,3-difluoro-5-phenylmethoxybenzene |
| InChIKey | MMGUMGXGICRLQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C(=C2)F)Br)F |
Computed by PubChem (NCBI)