Products 1968478-77-4
CAS 1968478-77-4 is the registry number for (3-bromo-2,6-difluorophenyl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3-bromo-2,6-difluorophenyl)-phenylmethanol (CAS 1968478-77-4) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: (3-bromo-2,6-difluorophenyl)-phenylmethanol. InChIKey: KZXNETCCIRQCLV-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | (3-bromo-2,6-difluorophenyl)-phenylmethanol |
| InChIKey | KZXNETCCIRQCLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=CC(=C2F)Br)F)O |
Computed by PubChem (NCBI)