cas: 1017779-51-9 — see every product listed under this CAS number, including other names
2-(Bromomethyl)-5-ethoxy-1,3-difluorobenzene 98% (CAS 1017779-51-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A278963-250mg |
| cas | 1017779-51-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1766.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A278963 |
2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene (CAS 1017779-51-9) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene. InChIKey: FLUSMXIXICUDDW-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene |
| InChIKey | FLUSMXIXICUDDW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)F)CBr)F |
Computed by PubChem (NCBI)