cas: 1017779-51-9 — see every product listed under this CAS number, including other names
2-(Bromomethyl)-5-ethoxy-1,3-difluorobenzene (CAS 1017779-51-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228367-1G |
| cas | 1017779-51-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 914.28 Pln | |
| Fluorochem | 5g | 3132.25 Pln |
| delivery time | 2-3 weeks |
|---|
2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene (CAS 1017779-51-9) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene. InChIKey: FLUSMXIXICUDDW-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene |
| InChIKey | FLUSMXIXICUDDW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)F)CBr)F |
Computed by PubChem (NCBI)