CAS 342816-14-2 is the registry number for 2-(Methanesulfonyl)benzylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2-methylsulfonylphenyl)methanamine;hydrochloride (CAS 342816-14-2) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: (2-methylsulfonylphenyl)methanamine;hydrochloride. InChIKey: ITWDFVUNCISBDX-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | (2-methylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | ITWDFVUNCISBDX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1CN.Cl |
Computed by PubChem (NCBI)