CAS 41940-43-6 appears in our catalog under these names: Ethyl 5-amino-3-methylthiophene-2-carboxylate hydrochloride, 95%, Ethyl 5-amino-3-methylthiophene-2-carboxylate hydrochloride. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 500mg.
Ethyl 5-amino-3-methylthiophene-2-carboxylate;hydrochloride (CAS 41940-43-6) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: ethyl 5-amino-3-methylthiophene-2-carboxylate;hydrochloride. InChIKey: ZBGUERNJHMVQLZ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | ethyl 5-amino-3-methylthiophene-2-carboxylate;hydrochloride |
| InChIKey | ZBGUERNJHMVQLZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(S1)N)C.Cl |
Computed by PubChem (NCBI)