Products 270065-91-3

CAS 270065-91-3 is the registry number for (S)-3-Amino-4-(2-thienyl)butanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(3S)-3-amino-4-thiophen-2-ylbutanoic acid;hydrochloride (CAS 270065-91-3) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: (3S)-3-amino-4-thiophen-2-ylbutanoic acid;hydrochloride. InChIKey: DPMHHGFSWLCCBH-FYZOBXCZSA-N.

Identity
Molecular formulaC8H12ClNO2S
Molecular weight221.71 g/mol
IUPAC name(3S)-3-amino-4-thiophen-2-ylbutanoic acid;hydrochloride
InChIKeyDPMHHGFSWLCCBH-FYZOBXCZSA-N
SMILESC1=CSC(=C1)C[C@H](CC(=O)O)N.Cl

Computed by PubChem (NCBI)