CAS 185463-13-2 is the registry number for Methyl (2S)-2-amino-3-(thiophen-3-yl)propanoate hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Methyl (2S)-2-amino-3-thiophen-3-ylpropanoate;hydrochloride (CAS 185463-13-2) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-thiophen-3-ylpropanoate;hydrochloride. InChIKey: OGXZQDVQMMXIGM-FJXQXJEOSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-thiophen-3-ylpropanoate;hydrochloride |
| InChIKey | OGXZQDVQMMXIGM-FJXQXJEOSA-N |
| SMILES | COC(=O)[C@H](CC1=CSC=C1)N.Cl |
Computed by PubChem (NCBI)