CAS 269726-91-2 appears in our catalog under these names: (R)-3-Amino-4-(3-thienyl)butanoic acid hydrochloride, 95%, (R)-3-Amino-4-(thiophen-3-yl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(3R)-3-amino-4-thiophen-3-ylbutanoic acid;hydrochloride (CAS 269726-91-2) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: (3R)-3-amino-4-thiophen-3-ylbutanoic acid;hydrochloride. InChIKey: QDZZLMYYGBIDFT-OGFXRTJISA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | (3R)-3-amino-4-thiophen-3-ylbutanoic acid;hydrochloride |
| InChIKey | QDZZLMYYGBIDFT-OGFXRTJISA-N |
| SMILES | C1=CSC=C1C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)