CAS 879685-29-7 appears in our catalog under these names: 4-(Ethanesulfonyl)aniline hydrochloride, 95%, 4-(Ethanesulfonyl)aniline hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
4-ethylsulfonylaniline;hydrochloride (CAS 879685-29-7) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: 4-ethylsulfonylaniline;hydrochloride. InChIKey: WTYYAXAHNXLQSW-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | 4-ethylsulfonylaniline;hydrochloride |
| InChIKey | WTYYAXAHNXLQSW-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)