CAS 1263378-01-3 appears in our catalog under these names: N-Methyl-4-(methylsulfonyl)aniline hydrochloride 97%, N-Methyl-4-(methylsulfonyl)aniline, HCl, 97%, 97%, N-Methyl-4-(methylsulfonyl)aniline hydrochloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
N-methyl-4-methylsulfonylaniline;hydrochloride (CAS 1263378-01-3) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: N-methyl-4-methylsulfonylaniline;hydrochloride. InChIKey: JLMAKOFZASQMNU-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | N-methyl-4-methylsulfonylaniline;hydrochloride |
| InChIKey | JLMAKOFZASQMNU-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)