cas: 61382-21-6 — see every product listed under this CAS number, including other names
2-(Pyridin-3-yl)benzo[d]oxazol-5-amine, 97%, 97% (CAS 61382-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F5X5-100mg |
| cas | 61382-21-6 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2392.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-pyridin-3-yl-1,3-benzoxazol-5-amine (CAS 61382-21-6) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 2-pyridin-3-yl-1,3-benzoxazol-5-amine. InChIKey: ITFJBVWVZSRNHZ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-pyridin-3-yl-1,3-benzoxazol-5-amine |
| InChIKey | ITFJBVWVZSRNHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)