CAS 4569-77-1 appears in our catalog under these names: 3-Amino-phenazin-2-ol, 95%, 2-Amino-3-hydroxy phenazine, 2-Amino-3-hydroxyphenazine, 2–Amino–3–Hydroxyphenazine, 3-Amino-phenazin-2-ol. Offered by: Combi-blocks, Chemat Brand, Mikromol, GLPBio, Biosynth. Available pack sizes: 5g, 1g, on request, 25mg, 100mg, 250mg, 25g, 0,5g.
3-aminophenazin-2-ol (CAS 4569-77-1) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 3-aminophenazin-2-ol. InChIKey: AJIRUIWLEVHQMU-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 3-aminophenazin-2-ol |
| InChIKey | AJIRUIWLEVHQMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=C(C(=CC3=N2)O)N |
Computed by PubChem (NCBI)