CAS 99445-26-8 is the registry number for 1-(1H-Indol-3-ylcarbonyl)-1h-imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Imidazol-1-yl(1H-indol-3-yl)methanone (CAS 99445-26-8) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: imidazol-1-yl(1H-indol-3-yl)methanone. InChIKey: SCCOEDPYQZHULK-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | imidazol-1-yl(1H-indol-3-yl)methanone |
| InChIKey | SCCOEDPYQZHULK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)N3C=CN=C3 |
Computed by PubChem (NCBI)