CAS 91493-94-6 appears in our catalog under these names: 2-Phenyl-7h-pyrrolo[2,3-d]pyrimidin-4-ol, 95%, 2-Phenyl-7H-pyrrolo(2,3-d)pyrimidin-4-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-phenyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (CAS 91493-94-6) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 2-phenyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one. InChIKey: FBCXXFFNKMCXBW-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-phenyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | FBCXXFFNKMCXBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CN3)C(=O)N2 |
Computed by PubChem (NCBI)