CAS 1016494-31-7 appears in our catalog under these names: 5-(1-Naphthyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(Naphthalen-1-yl)-1,3,4-oxadiazol-2-amine, 95-<97%, 5-(Naphthalen-1-yl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 25g, 50g, 100g.
5-naphthalen-1-yl-1,3,4-oxadiazol-2-amine (CAS 1016494-31-7) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 5-naphthalen-1-yl-1,3,4-oxadiazol-2-amine. InChIKey: VYISJPAVHRPXIH-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5-naphthalen-1-yl-1,3,4-oxadiazol-2-amine |
| InChIKey | VYISJPAVHRPXIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NN=C(O3)N |
Computed by PubChem (NCBI)