CAS 2140305-36-6 is the registry number for 1-(4-Aminophenyl)-2-oxopyridine-3-carbonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
1-(4-aminophenyl)-2-oxopyridine-3-carbonitrile (CAS 2140305-36-6) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 1-(4-aminophenyl)-2-oxopyridine-3-carbonitrile. InChIKey: SAMANBMPTAMPKR-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 1-(4-aminophenyl)-2-oxopyridine-3-carbonitrile |
| InChIKey | SAMANBMPTAMPKR-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)C#N)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)