CAS 198893-71-9 is the registry number for 5-(Naphthalen-2-yl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5-naphthalen-2-yl-1,3,4-oxadiazol-2-amine (CAS 198893-71-9) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 5-naphthalen-2-yl-1,3,4-oxadiazol-2-amine. InChIKey: UNYFQKGWGIABDA-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5-naphthalen-2-yl-1,3,4-oxadiazol-2-amine |
| InChIKey | UNYFQKGWGIABDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NN=C(O3)N |
Computed by PubChem (NCBI)