CAS 885-70-1 appears in our catalog under these names: 5,11-Dihydropyrido[2,3-b][1,4]benzodiazepin-6-one, 98%, 5,11-Dihydro-6H-pyrido(2,3-b)(1,4)benzodiazepin-6-one, >95% (HPLC), LS-75 98%, LS-75, 99.31%, 5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one, 98%, 98%. Offered by: Combi-blocks, TRC, Ambeed, MedChemExpress, Chemat. Available pack sizes: 25g, 5g, 1g, 2,5g, 250mg, 100g, 5 g, 1 g.
5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one (CAS 885-70-1) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one. InChIKey: MIRBIZDDMSFTKY-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one |
| InChIKey | MIRBIZDDMSFTKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(N2)N=CC=C3 |
Computed by PubChem (NCBI)