CAS 102791-46-8 appears in our catalog under these names: 6-(1-Pyrazolyl)-2-quinolone, 95%, 6-(1H-Pyrazol-1-yl)-2(1H)-quinolinone, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg.
6-pyrazol-1-yl-1H-quinolin-2-one (CAS 102791-46-8) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 6-pyrazol-1-yl-1H-quinolin-2-one. InChIKey: HFGKTRGWPPAWOL-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 6-pyrazol-1-yl-1H-quinolin-2-one |
| InChIKey | HFGKTRGWPPAWOL-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC3=C(C=C2)NC(=O)C=C3 |
Computed by PubChem (NCBI)