cas: 1451390-83-2 — see every product listed under this CAS number, including other names
2-(tert-Butylcarbonylamino)-6-chlorophenylboronic acid (CAS 1451390-83-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628012-1G |
| cas | 1451390-83-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2382.51 Pln |
| delivery time | 3-4 weeks |
|---|
[2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 1451390-83-2) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: SPNIKRUJDDBTIY-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | SPNIKRUJDDBTIY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Cl)NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)