cas: 1451390-83-2 — see every product listed under this CAS number, including other names
(2-Chloro-6-pivalamidophenyl)boronic acid, 98+% (CAS 1451390-83-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A578500-10g |
| cas | 1451390-83-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17588.41 Pln | |
| AmBeed | 25g | 34514.41 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 1451390-83-2) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: SPNIKRUJDDBTIY-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | SPNIKRUJDDBTIY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Cl)NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)