cas: 1187933-13-6 — see every product listed under this CAS number, including other names
2-[2-(Trifluoromethyl)phenyl]cyclopropanecarboxylic Acid, 95% (trans), 95% (trans) (CAS 1187933-13-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103E7-1g |
| cas | 1187933-13-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 846.80 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 5g | 2805.20 Pln |
| purity | 95% (trans) |
|---|---|
| delivery time | 3 weeks |
2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 1187933-13-6) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: SHCKKENSUDTLMS-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | SHCKKENSUDTLMS-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)