CAS 1187933-13-6 appears in our catalog under these names: 2-(2-Trifluoromethyl-phenyl)-cyclopropanecarboxylic acid, 95%, 2–(2–(Trifluoromethyl)phenyl)cyclopropanecarboxylic Acid, 2-(2-(Trifluoromethyl)phenyl)cyclopropanecarboxylic acid, 2-[2-(Trifluoromethyl)phenyl]cyclopropanecarboxylic Acid 95% (trans), 2-[2-(Trifluoromethyl)phenyl]cyclopropanecarboxylic Acid, 95% (trans), 95% (trans). Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 1187933-13-6) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: SHCKKENSUDTLMS-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | SHCKKENSUDTLMS-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)