CAS 157518-49-5 appears in our catalog under these names: rel-(1R,2R)-2-(2-(Trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, rel-(1R,2R)-2-(2-(Trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, >95%, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
Trans-(1R,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 157518-49-5) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: trans-(1R,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: SHCKKENSUDTLMS-JGVFFNPUSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | SHCKKENSUDTLMS-JGVFFNPUSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)