CAS 606-18-8 appears in our catalog under these names: 2-Amino-3-nitrobenzoic Acid, 2–Amino–3–nitrobenzoic acid, 2-Amino-3-nitrobenzoic acid, 97% , 2-Amino-3-nitrobenzoic Acid, >97.0%(T), 2-Amino-3-nitrobenzoic acid, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 50g, 1000g, 250g.
2-amino-3-nitrobenzoic acid (CAS 606-18-8) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 2-amino-3-nitrobenzoic acid. InChIKey: JJPIVRWTAGQTPQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-amino-3-nitrobenzoic acid |
| InChIKey | JJPIVRWTAGQTPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)